Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Glycoluril, 97%
CAS: 496-46-8 Molecular Formula: C4H6N4O2 Molecular Weight (g/mol): 142.12 InChI Key: VPVSTMAPERLKKM-UHFFFAOYSA-N Synonym: glycoluril,acetyleneurea,acetylenediureine,acetylenediurea,glyoxalbiuret,glyoxaldiureine,acetylene carbamide,diurea glyoxalate,tetrahydroimidazo 4,5-d imidazole-2,5 1h,3h-dione,glyoxaldiurene PubChem CID: 62347 ChEBI: CHEBI:42946 IUPAC Name: 1,3,3a,4,6,6a-hexahydroimidazo[4,5-d]imidazole-2,5-dione SMILES: C12C(NC(=O)N1)NC(=O)N2
| PubChem CID | 62347 |
|---|---|
| CAS | 496-46-8 |
| Molecular Weight (g/mol) | 142.12 |
| ChEBI | CHEBI:42946 |
| SMILES | C12C(NC(=O)N1)NC(=O)N2 |
| Synonym | glycoluril,acetyleneurea,acetylenediureine,acetylenediurea,glyoxalbiuret,glyoxaldiureine,acetylene carbamide,diurea glyoxalate,tetrahydroimidazo 4,5-d imidazole-2,5 1h,3h-dione,glyoxaldiurene |
| IUPAC Name | 1,3,3a,4,6,6a-hexahydroimidazo[4,5-d]imidazole-2,5-dione |
| InChI Key | VPVSTMAPERLKKM-UHFFFAOYSA-N |
| Molecular Formula | C4H6N4O2 |
1-Ethyl-3-methylimidazolium bromide, 98%
CAS: 65039-08-9 Molecular Formula: C6H11BrN2 Molecular Weight (g/mol): 191.07 MDL Number: MFCD03427610 InChI Key: GWQYPLXGJIXMMV-UHFFFAOYSA-M Synonym: 1-ethyl-3-methylimidazolium bromide,3-ethyl-1-methyl-1h-imidazol-3-ium bromide,1-ethyl-3-methylmidazolium bromide,unii-xo254ye73i,1-ethyl-3-methyl-1h-imidazol-3-ium bromide,acmc-1b3a0,dsstox_cid_29300,dsstox_rid_83418,dsstox_gsid_49343,c6h11n2.br PubChem CID: 2734235 SMILES: [Br-].CCN1C=C[N+](C)=C1
| PubChem CID | 2734235 |
|---|---|
| CAS | 65039-08-9 |
| Molecular Weight (g/mol) | 191.07 |
| MDL Number | MFCD03427610 |
| SMILES | [Br-].CCN1C=C[N+](C)=C1 |
| Synonym | 1-ethyl-3-methylimidazolium bromide,3-ethyl-1-methyl-1h-imidazol-3-ium bromide,1-ethyl-3-methylmidazolium bromide,unii-xo254ye73i,1-ethyl-3-methyl-1h-imidazol-3-ium bromide,acmc-1b3a0,dsstox_cid_29300,dsstox_rid_83418,dsstox_gsid_49343,c6h11n2.br |
| InChI Key | GWQYPLXGJIXMMV-UHFFFAOYSA-M |
| Molecular Formula | C6H11BrN2 |
Indole 99.0+%, TCI America™
CAS: 120-72-9 Molecular Formula: C8H7N Molecular Weight (g/mol): 117.151 MDL Number: MFCD00005607 InChI Key: SIKJAQJRHWYJAI-UHFFFAOYSA-N Synonym: indole,indol,2,3-benzopyrrole,1-benzazole,ketole,1-azaindene,benzopyrrole,2,3-benzopyrole,caswell no. 498b,indol german PubChem CID: 798 ChEBI: CHEBI:16881 IUPAC Name: 1H-indole SMILES: C1=CC=C2C(=C1)C=CN2
| PubChem CID | 798 |
|---|---|
| CAS | 120-72-9 |
| Molecular Weight (g/mol) | 117.151 |
| ChEBI | CHEBI:16881 |
| MDL Number | MFCD00005607 |
| SMILES | C1=CC=C2C(=C1)C=CN2 |
| Synonym | indole,indol,2,3-benzopyrrole,1-benzazole,ketole,1-azaindene,benzopyrrole,2,3-benzopyrole,caswell no. 498b,indol german |
| IUPAC Name | 1H-indole |
| InChI Key | SIKJAQJRHWYJAI-UHFFFAOYSA-N |
| Molecular Formula | C8H7N |
1-Butylamine, 99%
CAS: 109-73-9 Molecular Formula: C4H11N Molecular Weight (g/mol): 73.139 MDL Number: MFCD00011690 InChI Key: HQABUPZFAYXKJW-UHFFFAOYSA-N Synonym: butylamine,n-butylamine,1-butanamine,1-aminobutane,1-butylamine,monobutylamine,n-butylamin,mono-n-butylamine,norvalamine,1-aminobutan PubChem CID: 8007 ChEBI: CHEBI:43799 IUPAC Name: butan-1-amine SMILES: CCCCN
| PubChem CID | 8007 |
|---|---|
| CAS | 109-73-9 |
| Molecular Weight (g/mol) | 73.139 |
| ChEBI | CHEBI:43799 |
| MDL Number | MFCD00011690 |
| SMILES | CCCCN |
| Synonym | butylamine,n-butylamine,1-butanamine,1-aminobutane,1-butylamine,monobutylamine,n-butylamin,mono-n-butylamine,norvalamine,1-aminobutan |
| IUPAC Name | butan-1-amine |
| InChI Key | HQABUPZFAYXKJW-UHFFFAOYSA-N |
| Molecular Formula | C4H11N |
4-Methoxybenzamide, 98%
CAS: 3424-93-9 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.165 MDL Number: MFCD00007995 InChI Key: GUCPYIYFQVTFSI-UHFFFAOYSA-N Synonym: p-anisamide,p-methoxybenzamide,benzamide, 4-methoxy,4-methoxy benzamide,p-methyoxybenzamide,unii-z85fx3977e,4-methoxy-benzamide,4-anisamide,acmc-1cjjo,4-methoxylbenzamide PubChem CID: 76959 IUPAC Name: 4-methoxybenzamide SMILES: COC1=CC=C(C=C1)C(=O)N
| PubChem CID | 76959 |
|---|---|
| CAS | 3424-93-9 |
| Molecular Weight (g/mol) | 151.165 |
| MDL Number | MFCD00007995 |
| SMILES | COC1=CC=C(C=C1)C(=O)N |
| Synonym | p-anisamide,p-methoxybenzamide,benzamide, 4-methoxy,4-methoxy benzamide,p-methyoxybenzamide,unii-z85fx3977e,4-methoxy-benzamide,4-anisamide,acmc-1cjjo,4-methoxylbenzamide |
| IUPAC Name | 4-methoxybenzamide |
| InChI Key | GUCPYIYFQVTFSI-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |
Manganese(III)acetylacetonate, 97%
CAS: 14284-89-0 Molecular Formula: C15H21MnO6 Molecular Weight (g/mol): 352.27 MDL Number: MFCD00000023 InChI Key: HYZQBNDRDQEWAN-LNTINUHCSA-K Synonym: mn iii acetylacetonate,tris acetylacetonato manganese iii PubChem CID: 122130696 IUPAC Name: manganese(3+);(E)-4-oxopent-2-en-2-olate SMILES: [Mn+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 122130696 |
|---|---|
| CAS | 14284-89-0 |
| Molecular Weight (g/mol) | 352.27 |
| MDL Number | MFCD00000023 |
| SMILES | [Mn+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | mn iii acetylacetonate,tris acetylacetonato manganese iii |
| IUPAC Name | manganese(3+);(E)-4-oxopent-2-en-2-olate |
| InChI Key | HYZQBNDRDQEWAN-LNTINUHCSA-K |
| Molecular Formula | C15H21MnO6 |
Urea, 99.3+%
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Polydimethylsiloxane, trimethylsiloxy terminated, M.W. 2000
CAS: 9016-00-6 Molecular Formula: (C2H6OSi)n Molecular Weight (g/mol): 74.15 MDL Number: MFCD00084411 InChI Key: SEUDSDUUJXTXSV-UHFFFAOYSA-N IUPAC Name: dimethylsilanone SMILES: C[Si](C)(-*)O-*
| CAS | 9016-00-6 |
|---|---|
| Molecular Weight (g/mol) | 74.15 |
| MDL Number | MFCD00084411 |
| SMILES | C[Si](C)(-*)O-* |
| IUPAC Name | dimethylsilanone |
| InChI Key | SEUDSDUUJXTXSV-UHFFFAOYSA-N |
| Molecular Formula | (C2H6OSi)n |
2-Naphthaldehyde, 98%
CAS: 66-99-9 Molecular Formula: C11H8O Molecular Weight (g/mol): 156.18 MDL Number: MFCD00004094 InChI Key: PJKVFARRVXDXAD-UHFFFAOYSA-N Synonym: 2-naphthaldehyde,2-naphthalenecarboxaldehyde,2-formylnaphthalene,beta-naphthaldehyde,beta-formylnaphthalene,beta-naphthylaldehyde,beta-naphthylcarboxaldehyde,.beta.-naphthaldehyde,.beta.-naphthylaldehyde,.beta.-formylnaphthalene PubChem CID: 6201 ChEBI: CHEBI:52368 IUPAC Name: naphthalene-2-carbaldehyde SMILES: C1=CC=C2C=C(C=CC2=C1)C=O
| PubChem CID | 6201 |
|---|---|
| CAS | 66-99-9 |
| Molecular Weight (g/mol) | 156.18 |
| ChEBI | CHEBI:52368 |
| MDL Number | MFCD00004094 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C=O |
| Synonym | 2-naphthaldehyde,2-naphthalenecarboxaldehyde,2-formylnaphthalene,beta-naphthaldehyde,beta-formylnaphthalene,beta-naphthylaldehyde,beta-naphthylcarboxaldehyde,.beta.-naphthaldehyde,.beta.-naphthylaldehyde,.beta.-formylnaphthalene |
| IUPAC Name | naphthalene-2-carbaldehyde |
| InChI Key | PJKVFARRVXDXAD-UHFFFAOYSA-N |
| Molecular Formula | C11H8O |
Iminostilbene, 97%
CAS: 256-96-2 Molecular Formula: C14H11N Molecular Weight (g/mol): 193.249 MDL Number: MFCD00005071 InChI Key: LCGTWRLJTMHIQZ-UHFFFAOYSA-N Synonym: iminostilbene,5h-dibenzo b,f azepine,5h-dibenz b,f azepine,2,2'-iminostilbene,dibenz b,f azepine,2,3,6,7-dibenzazepine,stilbene, 2,2'-imino PubChem CID: 9212 ChEBI: CHEBI:47802 IUPAC Name: 11H-benzo[b][1]benzazepine SMILES: C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2
| PubChem CID | 9212 |
|---|---|
| CAS | 256-96-2 |
| Molecular Weight (g/mol) | 193.249 |
| ChEBI | CHEBI:47802 |
| MDL Number | MFCD00005071 |
| SMILES | C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2 |
| Synonym | iminostilbene,5h-dibenzo b,f azepine,5h-dibenz b,f azepine,2,2'-iminostilbene,dibenz b,f azepine,2,3,6,7-dibenzazepine,stilbene, 2,2'-imino |
| IUPAC Name | 11H-benzo[b][1]benzazepine |
| InChI Key | LCGTWRLJTMHIQZ-UHFFFAOYSA-N |
| Molecular Formula | C14H11N |
4,4'-Methylenebis(2-methylcyclohexylamine), 99%, mixture of isomers
CAS: 6864-37-5 Molecular Formula: C15H30N2 Molecular Weight (g/mol): 238.42 MDL Number: MFCD00075535 InChI Key: IGSBHTZEJMPDSZ-UHFFFAOYNA-N Synonym: 4,4'-methylenebis 2-methylcyclohexanamine,bis 4-amino-3-methylcyclohexyl methane,cyclohexanamine, 4,4'-methylenebis 2-methyl,4,4'-methylenebis 2-methylcyclohexylamine,3,3'-dimethyl-4,4'-diaminodicyclohexylmethane,2,2'-dimethyl-4,4'-methylenebis cyclohexylamine,4-4-amino-3-methylcyclohexyl methyl-2-methylcyclohexan-1-amine,4,4'-methylenebis 2-methylcyclohexyl-amine,2,2'-dimethyl-4,4'methylenebis cyclohexylamine PubChem CID: 91555 IUPAC Name: 4-[(4-amino-3-methylcyclohexyl)methyl]-2-methylcyclohexan-1-amine SMILES: CC1CC(CC2CCC(N)C(C)C2)CCC1N
| PubChem CID | 91555 |
|---|---|
| CAS | 6864-37-5 |
| Molecular Weight (g/mol) | 238.42 |
| MDL Number | MFCD00075535 |
| SMILES | CC1CC(CC2CCC(N)C(C)C2)CCC1N |
| Synonym | 4,4'-methylenebis 2-methylcyclohexanamine,bis 4-amino-3-methylcyclohexyl methane,cyclohexanamine, 4,4'-methylenebis 2-methyl,4,4'-methylenebis 2-methylcyclohexylamine,3,3'-dimethyl-4,4'-diaminodicyclohexylmethane,2,2'-dimethyl-4,4'-methylenebis cyclohexylamine,4-4-amino-3-methylcyclohexyl methyl-2-methylcyclohexan-1-amine,4,4'-methylenebis 2-methylcyclohexyl-amine,2,2'-dimethyl-4,4'methylenebis cyclohexylamine |
| IUPAC Name | 4-[(4-amino-3-methylcyclohexyl)methyl]-2-methylcyclohexan-1-amine |
| InChI Key | IGSBHTZEJMPDSZ-UHFFFAOYNA-N |
| Molecular Formula | C15H30N2 |
Hydroxyacetone, 95%
CAS: 116-09-6 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.079 MDL Number: MFCD00004669 InChI Key: XLSMFKSTNGKWQX-UHFFFAOYSA-N Synonym: hydroxyacetone,acetol,acetone alcohol,1-hydroxy-2-propanone,2-propanone, 1-hydroxy,1-hydroxyacetone,methanol, acetyl,acetylmethanol,acetylcarbinol,2-oxopropanol PubChem CID: 8299 ChEBI: CHEBI:27957 IUPAC Name: 1-hydroxypropan-2-one SMILES: CC(=O)CO
| PubChem CID | 8299 |
|---|---|
| CAS | 116-09-6 |
| Molecular Weight (g/mol) | 74.079 |
| ChEBI | CHEBI:27957 |
| MDL Number | MFCD00004669 |
| SMILES | CC(=O)CO |
| Synonym | hydroxyacetone,acetol,acetone alcohol,1-hydroxy-2-propanone,2-propanone, 1-hydroxy,1-hydroxyacetone,methanol, acetyl,acetylmethanol,acetylcarbinol,2-oxopropanol |
| IUPAC Name | 1-hydroxypropan-2-one |
| InChI Key | XLSMFKSTNGKWQX-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Methacrylic acid, 99+%, stab. with 250ppm 4-methoxyphenol
CAS: 79-41-4 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 MDL Number: MFCD00002651 InChI Key: CERQOIWHTDAKMF-UHFFFAOYSA-N Synonym: methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl PubChem CID: 4093 ChEBI: CHEBI:25219 IUPAC Name: 2-methylprop-2-enoic acid SMILES: CC(=C)C(=O)O
| PubChem CID | 4093 |
|---|---|
| CAS | 79-41-4 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:25219 |
| MDL Number | MFCD00002651 |
| SMILES | CC(=C)C(=O)O |
| Synonym | methacrylic acid,2-methylacrylic acid,2-propenoic acid, 2-methyl,methylacrylic acid,2-methylpropenoic acid,2-methyl-2-propenoic acid,alpha-methacrylic acid,alpha-methylacrylic acid,2-methylenepropionic acid,acrylic acid, 2-methyl |
| IUPAC Name | 2-methylprop-2-enoic acid |
| InChI Key | CERQOIWHTDAKMF-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
1-Pentanesulfonic acid, sodium salt monohydrate, 98+%, HPLC grade
CAS: 207605-40-1 Molecular Formula: C5H11NaO3S·H2O Molecular Weight (g/mol): 192.22 MDL Number: MFCD00149548 InChI Key: FPQYXAFKHLSWTI-UHFFFAOYSA-M Synonym: sodium pentane-1-sulfonate hydrate,1-pentanesulfonic acid sodium salt monohydrate,sodium 1-pentanesulfonate monohydrate,potassium hydrate pentane-1-sulfonate,sodium 1-pentanesulfonate hydrate,sodium hydrate pentane-1-sulfonate,sodium pentane-1-sulfonate-water 1/1/1,1-pentane sulphonic acid sodium salt monohydrate,1-pentanesulfonic acid sodium salt monohydydrate,sodium 1-pentanesulfonate monohydrate, hplc grade PubChem CID: 23693099 IUPAC Name: sodium;pentane-1-sulfonate;hydrate SMILES: CCCCCS(=O)(=O)[O-].O.[Na+]
| PubChem CID | 23693099 |
|---|---|
| CAS | 207605-40-1 |
| Molecular Weight (g/mol) | 192.22 |
| MDL Number | MFCD00149548 |
| SMILES | CCCCCS(=O)(=O)[O-].O.[Na+] |
| Synonym | sodium pentane-1-sulfonate hydrate,1-pentanesulfonic acid sodium salt monohydrate,sodium 1-pentanesulfonate monohydrate,potassium hydrate pentane-1-sulfonate,sodium 1-pentanesulfonate hydrate,sodium hydrate pentane-1-sulfonate,sodium pentane-1-sulfonate-water 1/1/1,1-pentane sulphonic acid sodium salt monohydrate,1-pentanesulfonic acid sodium salt monohydydrate,sodium 1-pentanesulfonate monohydrate, hplc grade |
| IUPAC Name | sodium;pentane-1-sulfonate;hydrate |
| InChI Key | FPQYXAFKHLSWTI-UHFFFAOYSA-M |
| Molecular Formula | C5H11NaO3S·H2O |
4'-tert-Butylacetophenone, 98%, Thermo Scientific Chemicals
CAS: 943-27-1 Molecular Formula: C12H16O Molecular Weight (g/mol): 176.26 MDL Number: MFCD00017256 InChI Key: UYFJYGWNYQCHOB-UHFFFAOYSA-N Synonym: 4'-tert-butylacetophenone,1-4-tert-butylphenyl ethanone,4-tert-butylacetophenone,1-4-tert-butyl phenyl ethanone,p-tert-butylacetophenone,ethanone, 1-4-1,1-dimethylethyl phenyl,acetophenone, 4'-tert-butyl,1-4-tert-butyl phenyl ethan-1-one,p-t-butylacetophenone,1-4-tert-butyl-phenyl-ethanone PubChem CID: 13669 IUPAC Name: 1-(4-tert-butylphenyl)ethanone SMILES: CC(=O)C1=CC=C(C=C1)C(C)(C)C
| PubChem CID | 13669 |
|---|---|
| CAS | 943-27-1 |
| Molecular Weight (g/mol) | 176.26 |
| MDL Number | MFCD00017256 |
| SMILES | CC(=O)C1=CC=C(C=C1)C(C)(C)C |
| Synonym | 4'-tert-butylacetophenone,1-4-tert-butylphenyl ethanone,4-tert-butylacetophenone,1-4-tert-butyl phenyl ethanone,p-tert-butylacetophenone,ethanone, 1-4-1,1-dimethylethyl phenyl,acetophenone, 4'-tert-butyl,1-4-tert-butyl phenyl ethan-1-one,p-t-butylacetophenone,1-4-tert-butyl-phenyl-ethanone |
| IUPAC Name | 1-(4-tert-butylphenyl)ethanone |
| InChI Key | UYFJYGWNYQCHOB-UHFFFAOYSA-N |
| Molecular Formula | C12H16O |